Structure of PDB 6kzv Chain A Binding Site BS01 |
|
|
Ligand ID | E0F |
InChI | InChI=1S/C24H27N3O2/c1-27(19-11-3-2-4-12-19)16-18-10-6-8-14-22(18)26-24(29)20-15-17-9-5-7-13-21(17)25-23(20)28/h5-10,13-15,19H,2-4,11-12,16H2,1H3,(H,25,28)(H,26,29) |
InChIKey | HXOAPOMHVOADBB-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 OpenEye OEToolkits 2.0.7 | CN(Cc1ccccc1NC(=O)C2=Cc3ccccc3NC2=O)C4CCCCC4 |
|
Formula | C24 H27 N3 O2 |
Name | ~{N}-[2-[[cyclohexyl(methyl)amino]methyl]phenyl]-2-oxidanylidene-1~{H}-quinoline-3-carboxamide; N-(2-{[cyclohexyl(methyl)amino]methyl}phenyl)-2-oxo-1,2-dihydroquinoline-3-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000036390838
|
PDB chain | 6kzv Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
5.6.2.2: DNA topoisomerase (ATP-hydrolyzing). |
|
|
|