Structure of PDB 6kvy Chain A Binding Site BS01 |
|
|
Ligand ID | AVJ |
InChI | InChI=1S/C9H15N3O2/c1-12(2,3)8(9(13)14)4-7-5-10-6-11-7/h5-6,8H,4H2,1-3H3,(H-,10,11,13,14)/p+1/t8-/m0/s1 |
InChIKey | GPPYTCRVKHULJH-QMMMGPOBSA-O |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[N+](C)(C)[CH](Cc1[nH]cnc1)C(O)=O | ACDLabs 12.01 | O=C(O)C(Cc1cncn1)[N+](C)(C)C | CACTVS 3.385 | C[N+](C)(C)[C@@H](Cc1[nH]cnc1)C(O)=O | OpenEye OEToolkits 1.7.6 | C[N+](C)(C)C(Cc1cnc[nH]1)C(=O)O | OpenEye OEToolkits 1.7.6 | C[N+](C)(C)[C@@H](Cc1cnc[nH]1)C(=O)O |
|
Formula | C9 H16 N3 O2 |
Name | N,N,N-trimethyl-histidine; Hercynine |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6kvy Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|