Structure of PDB 6ku2 Chain A Binding Site BS01 |
|
|
Ligand ID | DV6 |
InChI | InChI=1S/C9H17N3O2S2/c1-12(2,3)7(8(13)14)4-6-5-10-9(11-6)16-15/h5,7,9-11H,4H2,1-3H3,(H-,13,14,15)/p+1/t7-,9-/m0/s1 |
InChIKey | XGMLHKDWXWTLLL-CBAPKCEASA-O |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[N+](C)(C)[C@@H](CC1=CN[C@@H](N1)SS)C(O)=O | OpenEye OEToolkits 2.0.7 | C[N+](C)(C)[C@@H](CC1=CN[C@@H](N1)SS)C(=O)O | CACTVS 3.385 | C[N+](C)(C)[CH](CC1=CN[CH](N1)SS)C(O)=O | OpenEye OEToolkits 2.0.7 | C[N+](C)(C)C(CC1=CNC(N1)SS)C(=O)O |
|
Formula | C9 H18 N3 O2 S2 |
Name | [(2S)-3-[(2S)-2-(disulfanyl)-2,3-dihydro-1H-imidazol-4-yl]-1-oxidanyl-1-oxidanylidene-propan-2-yl]-trimethyl-azanium |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6ku2 Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|