Structure of PDB 6kki Chain A Binding Site BS01 |
|
|
Ligand ID | IPT |
InChI | InChI=1S/C9H18O5S/c1-4(2)15-9-8(13)7(12)6(11)5(3-10)14-9/h4-13H,3H2,1-2H3/t5-,6+,7+,8-,9+/m1/s1 |
InChIKey | BPHPUYQFMNQIOC-NXRLNHOXSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | CC(C)S[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O | ACDLabs 10.04 | S(C(C)C)C1OC(C(O)C(O)C1O)CO | OpenEye OEToolkits 1.5.0 | CC(C)S[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)CO)O)O)O | OpenEye OEToolkits 1.5.0 | CC(C)SC1C(C(C(C(O1)CO)O)O)O | CACTVS 3.341 | CC(C)S[CH]1O[CH](CO)[CH](O)[CH](O)[CH]1O |
|
Formula | C9 H18 O5 S |
Name | 1-methylethyl 1-thio-beta-D-galactopyranoside; ISOPROPYL-1-BETA-D-THIOGALACTOSIDE; 1-(ISOPROPYLTHIO)-BETA-GALACTOPYRANSIDE; 1-methylethyl 1-thio-beta-D-galactoside; 1-methylethyl 1-thio-D-galactoside; 1-methylethyl 1-thio-galactoside |
ChEMBL | |
DrugBank | DB01862 |
ZINC | ZINC000004261913
|
PDB chain | 6kki Chain A Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|