Structure of PDB 6ka5 Chain A Binding Site BS01 |
|
|
Ligand ID | 1S7 |
InChI | InChI=1S/C15H16N2O5S2/c1-9-7-24-14(16-12(9)13(20)21)15(8-18,22-2)17-11(19)6-10-4-3-5-23-10/h3-5,8,14H,1,6-7H2,2H3,(H,17,19)(H,20,21)/t14-,15+/m1/s1 |
InChIKey | BMQDZZSQSZJJQV-CABCVRRESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CO[C@@](NC(=O)Cc1sccc1)(C=O)[C@H]2SCC(=C)C(=N2)C(O)=O | OpenEye OEToolkits 1.7.6 | COC(C=O)(C1N=C(C(=C)CS1)C(=O)O)NC(=O)Cc2cccs2 | ACDLabs 12.01 | O=CC(OC)(NC(=O)Cc1sccc1)C2N=C(C(=O)O)\C(=C)CS2 | OpenEye OEToolkits 1.7.6 | CO[C@@](C=O)([C@@H]1N=C(C(=C)CS1)C(=O)O)NC(=O)Cc2cccs2 | CACTVS 3.370 | CO[C](NC(=O)Cc1sccc1)(C=O)[CH]2SCC(=C)C(=N2)C(O)=O |
|
Formula | C15 H16 N2 O5 S2 |
Name | (2R)-2-{(1S)-1-methoxy-2-oxo-1-[(thiophen-2-ylacetyl)amino]ethyl}-5-methylidene-5,6-dihydro-2H-1,3-thiazine-4-carboxylic acid; Cefoxitin, bound form |
ChEMBL | |
DrugBank | |
ZINC | ZINC000263620276
|
PDB chain | 6ka5 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|