Structure of PDB 6jsg Chain A Binding Site BS01 |
|
|
Ligand ID | C6U |
InChI | InChI=1S/C17H16ClFN4OS/c1-17(6-7-25-16(20)23-17)12-8-11(3-4-13(12)19)22-15(24)14-5-2-10(18)9-21-14/h2-5,8-9H,6-7H2,1H3,(H2,20,23)(H,22,24)/t17-/m0/s1 |
InChIKey | VVZZZUNCWSTIOI-KRWDZBQOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CC1(CCSC(=N1)N)c2cc(ccc2F)NC(=O)c3ccc(cn3)Cl | OpenEye OEToolkits 2.0.6 | C[C@]1(CCSC(=N1)N)c2cc(ccc2F)NC(=O)c3ccc(cn3)Cl | CACTVS 3.385 | C[C@]1(CCSC(=N1)N)c2cc(NC(=O)c3ccc(Cl)cn3)ccc2F | CACTVS 3.385 | C[C]1(CCSC(=N1)N)c2cc(NC(=O)c3ccc(Cl)cn3)ccc2F |
|
Formula | C17 H16 Cl F N4 O S |
Name | N-[3-[(4S)-2-azanyl-4-methyl-5,6-dihydro-1,3-thiazin-4-yl]-4-fluoranyl-phenyl]-5-chloranyl-pyridine-2-carboxamide |
ChEMBL | CHEMBL2347211 |
DrugBank | |
ZINC | ZINC000034951408
|
PDB chain | 6jsg Chain A Residue 507
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|