Structure of PDB 6jmf Chain A Binding Site BS01 |
|
|
Ligand ID | 9FC |
InChI | InChI=1S/C20H24N6O/c1-12-5-4-6-14(9-12)24-20-15(18(23)27)10-13(11-21)19(26-20)25-17-8-3-2-7-16(17)22/h4-6,9-10,16-17H,2-3,7-8,22H2,1H3,(H2,23,27)(H2,24,25,26)/t16-,17+/m0/s1 |
InChIKey | XAMCCSYNPOEISO-DLBZAZTESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1cccc(Nc2nc(N[CH]3CCCC[CH]3N)c(cc2C(N)=O)C#N)c1 | CACTVS 3.385 | Cc1cccc(Nc2nc(N[C@@H]3CCCC[C@@H]3N)c(cc2C(N)=O)C#N)c1 | ACDLabs 12.01 | c1(C(N)=O)cc(c(nc1Nc2cc(C)ccc2)NC3CCCCC3N)C#N | OpenEye OEToolkits 2.0.6 | Cc1cccc(c1)Nc2c(cc(c(n2)NC3CCCCC3N)C#N)C(=O)N | OpenEye OEToolkits 2.0.6 | Cc1cccc(c1)Nc2c(cc(c(n2)N[C@@H]3CCCC[C@@H]3N)C#N)C(=O)N |
|
Formula | C20 H24 N6 O |
Name | 6-{[(1R,2S)-2-aminocyclohexyl]amino}-5-cyano-2-[(3-methylphenyl)amino]pyridine-3-carboxamide |
ChEMBL | CHEMBL4457164 |
DrugBank | |
ZINC |
|
PDB chain | 6jmf Chain A Residue 903
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|