Structure of PDB 6iiu Chain A Binding Site BS01 |
|
|
Ligand ID | A8X |
InChI | InChI=1S/C21H21FN2O4S/c22-14-5-8-16(9-6-14)29(27,28)23-15-7-10-20-18(13-15)17-3-1-2-4-19(17)24(20)12-11-21(25)26/h1-6,8-9,15,23H,7,10-13H2,(H,25,26)/t15-/m1/s1 |
InChIKey | LDXDSHIEDAPSSA-OAHLLOKOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(=O)CCn1c2CC[CH](Cc2c3ccccc13)N[S](=O)(=O)c4ccc(F)cc4 | CACTVS 3.385 | OC(=O)CCn1c2CC[C@H](Cc2c3ccccc13)N[S](=O)(=O)c4ccc(F)cc4 | OpenEye OEToolkits 2.0.6 | c1ccc2c(c1)c3c(n2CCC(=O)O)CCC(C3)NS(=O)(=O)c4ccc(cc4)F | OpenEye OEToolkits 2.0.6 | c1ccc2c(c1)c3c(n2CCC(=O)O)CC[C@H](C3)NS(=O)(=O)c4ccc(cc4)F |
|
Formula | C21 H21 F N2 O4 S |
Name | 3-[(3R)-3-[(4-fluorophenyl)sulfonylamino]-1,2,3,4-tetrahydrocarbazol-9-yl]propanoic acid; Ramatroban |
ChEMBL | CHEMBL361812 |
DrugBank | DB13036 |
ZINC | ZINC000003798772
|
PDB chain | 6iiu Chain A Residue 9001
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|