Structure of PDB 6if0 Chain A Binding Site BS01 |
|
|
Ligand ID | A59 |
InChI | InChI=1S/C26H29NO3S/c1-2-3-4-7-21-9-10-23(20-24(21)11-14-25-8-5-6-17-27-25)22-12-15-26(16-13-22)31(29,30)19-18-28/h5-6,8-17,20,28H,2-4,7,18-19H2,1H3/b14-11- |
InChIKey | CNGQPWUWCYALEW-KAMYIIQDSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CCCCCc1ccc(cc1/C=C\c2ccccn2)c3ccc(cc3)S(=O)(=O)CCO | ACDLabs 12.01 | c3c(S(CCO)(=O)=O)ccc(c2cc([C@H]=Cc1ccccn1)c(cc2)CCCCC)c3 | CACTVS 3.385 | CCCCCc1ccc(cc1C=Cc2ccccn2)c3ccc(cc3)[S](=O)(=O)CCO | OpenEye OEToolkits 2.0.6 | CCCCCc1ccc(cc1C=Cc2ccccn2)c3ccc(cc3)S(=O)(=O)CCO | CACTVS 3.385 | CCCCCc1ccc(cc1\C=C/c2ccccn2)c3ccc(cc3)[S](=O)(=O)CCO |
|
Formula | C26 H29 N O3 S |
Name | 2-({4'-pentyl-3'-[(Z)-2-(pyridin-2-yl)ethenyl][1,1'-biphenyl]-4-yl}sulfonyl)ethan-1-ol |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6if0 Chain A Residue 600
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|