Structure of PDB 6ht1 Chain A Binding Site BS01 |
|
|
Ligand ID | GQ5 |
InChI | InChI=1S/C22H24N6O/c1-14-4-3-9-28(14)13-21-25-18-7-6-17(11-19(18)26-21)24-22(29)15-5-8-20-16(10-15)12-23-27(20)2/h5-8,10-12,14H,3-4,9,13H2,1-2H3,(H,24,29)(H,25,26)/t14-/m0/s1 |
InChIKey | QGNDVASWIHEXCL-AWEZNQCLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | C[C@H]1CCCN1Cc2[nH]c3cc(ccc3n2)NC(=O)c4ccc5c(c4)cnn5C | OpenEye OEToolkits 2.0.6 | CC1CCCN1Cc2[nH]c3cc(ccc3n2)NC(=O)c4ccc5c(c4)cnn5C | CACTVS 3.385 | C[CH]1CCCN1Cc2[nH]c3cc(NC(=O)c4ccc5n(C)ncc5c4)ccc3n2 | CACTVS 3.385 | C[C@H]1CCCN1Cc2[nH]c3cc(NC(=O)c4ccc5n(C)ncc5c4)ccc3n2 |
|
Formula | C22 H24 N6 O |
Name | 1-methyl-~{N}-[2-[[(2~{S})-2-methylpyrrolidin-1-yl]methyl]-3~{H}-benzimidazol-5-yl]indazole-5-carboxamide |
ChEMBL | CHEMBL4552313 |
DrugBank | |
ZINC |
|
PDB chain | 6ht1 Chain A Residue 210
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|