Structure of PDB 6hoe Chain A Binding Site BS01 |
|
|
Ligand ID | GH2 |
InChI | InChI=1S/C17H17F3N2O3S/c1-2-25-15(23)9-14-22-13(10-26-14)11-3-5-12(6-4-11)16(24)21-8-7-17(18,19)20/h3-6,10H,2,7-9H2,1H3,(H,21,24) |
InChIKey | BTOQSHVHCYLPJO-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CCOC(=O)Cc1nc(cs1)c2ccc(cc2)C(=O)NCCC(F)(F)F | CACTVS 3.385 | CCOC(=O)Cc1scc(n1)c2ccc(cc2)C(=O)NCCC(F)(F)F |
|
Formula | C17 H17 F3 N2 O3 S |
Name | ethyl 2-[4-[4-[3,3,3-tris(fluoranyl)propylcarbamoyl]phenyl]-1,3-thiazol-2-yl]ethanoate |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6hoe Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|