Structure of PDB 6hho Chain A Binding Site BS01 |
|
|
Ligand ID | G4W |
InChI | InChI=1S/C20H20F2N6O/c21-15-7-14(8-16(22)9-15)18-1-4-26-28(18)20(29)13-2-5-27(6-3-13)19-10-17(11-23)24-12-25-19/h7-10,12-13,18,26H,1-6H2/t18-/m0/s1 |
InChIKey | PZXPEVAQKNYNRX-SFHVURJKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Fc1cc(F)cc(c1)[CH]2CCNN2C(=O)C3CCN(CC3)c4cc(ncn4)C#N | OpenEye OEToolkits 2.0.6 | c1c(cc(cc1F)F)C2CCNN2C(=O)C3CCN(CC3)c4cc(ncn4)C#N | OpenEye OEToolkits 2.0.6 | c1c(cc(cc1F)F)[C@@H]2CCNN2C(=O)C3CCN(CC3)c4cc(ncn4)C#N | CACTVS 3.385 | Fc1cc(F)cc(c1)[C@@H]2CCNN2C(=O)C3CCN(CC3)c4cc(ncn4)C#N |
|
Formula | C20 H20 F2 N6 O |
Name | 6-[4-[(5~{S})-5-[3,5-bis(fluoranyl)phenyl]pyrazolidin-1-yl]carbonylpiperidin-1-yl]pyrimidine-4-carbonitrile; GSK547 |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6hho Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|