Structure of PDB 6hez Chain A Binding Site BS01 |
|
|
Ligand ID | 0SK |
InChI | InChI=1S/C17H18F3N3O4S/c1-9-8-26-16(27-9)2-4-23(5-3-16)15-21-14(24)11-6-10(17(18,19)20)7-12(22-25)13(11)28-15/h6-7,9,22,25H,2-5,8H2,1H3/t9-/m0/s1 |
InChIKey | WTTODOLGMIMGNK-VIFPVBQESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | C[C@H]1COC2(CCN(CC2)C3=NC(=O)c4cc(cc(NO)c4S3)C(F)(F)F)O1 | OpenEye OEToolkits 1.7.6 | C[C@H]1COC2(O1)CCN(CC2)C3=NC(=O)c4cc(cc(c4S3)NO)C(F)(F)F | ACDLabs 12.01 | FC(F)(F)c2cc(c1SC(=NC(=O)c1c2)N4CCC3(OCC(O3)C)CC4)NO | CACTVS 3.370 | C[CH]1COC2(CCN(CC2)C3=NC(=O)c4cc(cc(NO)c4S3)C(F)(F)F)O1 | OpenEye OEToolkits 1.7.6 | CC1COC2(O1)CCN(CC2)C3=NC(=O)c4cc(cc(c4S3)NO)C(F)(F)F |
|
Formula | C17 H18 F3 N3 O4 S |
Name | 8-(hydroxyamino)-2-[(2S)-2-methyl-1,4-dioxa-8-azaspiro[4.5]dec-8-yl]-6-(trifluoromethyl)-4H-1,3-benzothiazin-4-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920593
|
PDB chain | 6hez Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.1.98.3: decaprenylphospho-beta-D-ribofuranose 2-dehydrogenase. |
|
|
|