Structure of PDB 6gk9 Chain A Binding Site BS01 |
|
|
Ligand ID | F2K |
InChI | InChI=1S/C14H9ClN4O3/c15-7-3-1-6(2-4-7)9-8(5-16)11(17)22-13-10(9)12(20)18-14(21)19-13/h1-4,9H,17H2,(H2,18,19,20,21)/t9-/m0/s1 |
InChIKey | BQFPJAOKBASIPO-VIFPVBQESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | NC1=C(C#N)[CH](c2ccc(Cl)cc2)C3=C(NC(=O)NC3=O)O1 | OpenEye OEToolkits 2.0.6 | c1cc(ccc1C2C(=C(OC3=C2C(=O)NC(=O)N3)N)C#N)Cl | OpenEye OEToolkits 2.0.6 | c1cc(ccc1[C@H]2C(=C(OC3=C2C(=O)NC(=O)N3)N)C#N)Cl | CACTVS 3.385 | NC1=C(C#N)[C@H](c2ccc(Cl)cc2)C3=C(NC(=O)NC3=O)O1 |
|
Formula | C14 H9 Cl N4 O3 |
Name | (5~{S})-7-azanyl-5-(4-chlorophenyl)-2,4-bis(oxidanylidene)-1,5-dihydropyrano[2,3-d]pyrimidine-6-carbonitrile |
ChEMBL | |
DrugBank | |
ZINC | ZINC000000103154
|
PDB chain | 6gk9 Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.1.1.205: IMP dehydrogenase. |
|
|
|