Structure of PDB 6fuh Chain A Binding Site BS01 |
|
|
Ligand ID | E88 |
InChI | InChI=1S/C20H23N5O2/c1-12(2)17(19(26)27)24-20-23-16-9-4-3-8-15(16)18(25-20)22-14-7-5-6-13(10-14)11-21/h3-10,12,17H,11,21H2,1-2H3,(H,26,27)(H2,22,23,24,25)/t17-/m0/s1 |
InChIKey | SBAJWMCMBZQORT-KRWDZBQOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CC(C)[C@@H](C(=O)O)Nc1nc2ccccc2c(n1)Nc3cccc(c3)CN | CACTVS 3.385 | CC(C)[CH](Nc1nc(Nc2cccc(CN)c2)c3ccccc3n1)C(O)=O | OpenEye OEToolkits 2.0.6 | CC(C)C(C(=O)O)Nc1nc2ccccc2c(n1)Nc3cccc(c3)CN | CACTVS 3.385 | CC(C)[C@H](Nc1nc(Nc2cccc(CN)c2)c3ccccc3n1)C(O)=O |
|
Formula | C20 H23 N5 O2 |
Name | (2~{S})-2-[[4-[[3-(aminomethyl)phenyl]amino]quinazolin-2-yl]amino]-3-methyl-butanoic acid |
ChEMBL | CHEMBL4169870 |
DrugBank | |
ZINC |
|
PDB chain | 6fuh Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|