Structure of PDB 6ffe Chain A Binding Site BS01 |
|
|
Ligand ID | D7Q |
InChI | InChI=1S/C21H22N2O3/c1-14(24)23-19-9-5-4-8-18(19)22(13-20(23)15-10-11-15)12-16-6-2-3-7-17(16)21(25)26/h2-9,15,20H,10-13H2,1H3,(H,25,26)/t20-/m1/s1 |
InChIKey | PPKDQAUERJXIAY-HXUWFJFHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(=O)N1[CH](CN(Cc2ccccc2C(O)=O)c3ccccc13)C4CC4 | CACTVS 3.385 | CC(=O)N1[C@H](CN(Cc2ccccc2C(O)=O)c3ccccc13)C4CC4 | OpenEye OEToolkits 2.0.6 | CC(=O)N1c2ccccc2N(CC1C3CC3)Cc4ccccc4C(=O)O | OpenEye OEToolkits 2.0.6 | CC(=O)N1c2ccccc2N(C[C@@H]1C3CC3)Cc4ccccc4C(=O)O |
|
Formula | C21 H22 N2 O3 |
Name | 2-((4-acetyl-3-cyclopropyl-3,4-dihydroquinoxalin-1(2H)-yl)methyl)benzoic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6ffe Chain A Residue 505
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|