Structure of PDB 6fck Chain A Binding Site BS01 |
|
|
Ligand ID | D4Z |
InChI | InChI=1S/C20H22N4O/c21-20(25)15-8-9-17(23-14-7-4-10-22-12-14)16-11-18(24-19(15)16)13-5-2-1-3-6-13/h1-3,5-6,8-9,11,14,22-24H,4,7,10,12H2,(H2,21,25)/t14-/m0/s1 |
InChIKey | AQEDGKFVSWOMSY-AWEZNQCLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1ccc(cc1)c2cc3c(ccc(c3[nH]2)C(=O)N)N[C@H]4CCCNC4 | OpenEye OEToolkits 2.0.6 | c1ccc(cc1)c2cc3c(ccc(c3[nH]2)C(=O)N)NC4CCCNC4 | CACTVS 3.385 | NC(=O)c1ccc(N[C@H]2CCCNC2)c3cc([nH]c13)c4ccccc4 | CACTVS 3.385 | NC(=O)c1ccc(N[CH]2CCCNC2)c3cc([nH]c13)c4ccccc4 |
|
Formula | C20 H22 N4 O |
Name | 2-phenyl-4-[[(3~{S})-piperidin-3-yl]amino]-1~{H}-indole-7-carboxamide |
ChEMBL | CHEMBL4096683 |
DrugBank | |
ZINC |
|
PDB chain | 6fck Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|