Structure of PDB 6f3e Chain A Binding Site BS01 |
|
|
Ligand ID | CJQ |
InChI | InChI=1S/C21H28N4O3S/c22-17(26)11-13-1-6-16-18(13)19-20(23-12-24-21(19)29-16)28-15-4-2-14(3-5-15)25-7-9-27-10-8-25/h12-15H,1-11H2,(H2,22,26)/t13-,14-,15-/m1/s1 |
InChIKey | VZOLINZYKOLXAC-RBSFLKMASA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1nc(c2c3c(sc2n1)CC[C@@H]3CC(=O)N)OC4CCC(CC4)N5CCOCC5 | CACTVS 3.385 | NC(=O)C[CH]1CCc2sc3ncnc(O[CH]4CC[CH](CC4)N5CCOCC5)c3c12 | OpenEye OEToolkits 2.0.6 | c1nc(c2c3c(sc2n1)CCC3CC(=O)N)OC4CCC(CC4)N5CCOCC5 | CACTVS 3.385 | NC(=O)C[C@H]1CCc2sc3ncnc(O[C@@H]4CC[C@H](CC4)N5CCOCC5)c3c12 |
|
Formula | C21 H28 N4 O3 S |
Name | 2-[(3~{R})-12-(4-morpholin-4-ylcyclohexyl)oxy-7-thia-9,11-diazatricyclo[6.4.0.0^{2,6}]dodeca-1(8),2(6),9,11-tetraen-3-yl]ethanamide |
ChEMBL | CHEMBL3361254 |
DrugBank | |
ZINC |
|
PDB chain | 6f3e Chain A Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|