Structure of PDB 6f29 Chain A Binding Site BS01 |
|
|
Ligand ID | CGW |
InChI | InChI=1S/C9H11N3O4S/c10-5(8(14)15)1-12-6-3-17-2-4(6)7(13)11-9(12)16/h5H,1-3,10H2,(H,14,15)(H,11,13,16)/t5-/m0/s1 |
InChIKey | PETHBUJXGHVGGK-YFKPBYRVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | C1C2=C(CS1)N(C(=O)NC2=O)C[C@@H](C(=O)O)N | CACTVS 3.385 | N[C@@H](CN1C(=O)NC(=O)C2=C1CSC2)C(O)=O | CACTVS 3.385 | N[CH](CN1C(=O)NC(=O)C2=C1CSC2)C(O)=O | OpenEye OEToolkits 2.0.6 | C1C2=C(CS1)N(C(=O)NC2=O)CC(C(=O)O)N |
|
Formula | C9 H11 N3 O4 S |
Name | (2~{S})-2-azanyl-3-[2,4-bis(oxidanylidene)-5,7-dihydrothieno[3,4-d]pyrimidin-1-yl]propanoic acid |
ChEMBL | CHEMBL492469 |
DrugBank | |
ZINC | ZINC000040423756
|
PDB chain | 6f29 Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|