Structure of PDB 6exm Chain A Binding Site BS01 |
|
|
Ligand ID | QQH |
InChI | InChI=1S/C19H22N2O3S/c1-11-6-5-7-13(12(11)2)8-14-9-16(22)21-15(19(23)24)10-25-18(21)17(14)20(3)4/h5-7,9,15H,8,10H2,1-4H3,(H,23,24)/p+1/t15-/m0/s1 |
InChIKey | ROYOKFGWFIQXTM-HNNXBMFYSA-O |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[NH+](C)C1=C2SC[C@H](N2C(=O)C=C1Cc3cccc(C)c3C)C(O)=O | OpenEye OEToolkits 2.0.6 | Cc1cccc(c1C)CC2=CC(=O)N3C(CSC3=C2[NH+](C)C)C(=O)O | OpenEye OEToolkits 2.0.6 | Cc1cccc(c1C)CC2=CC(=O)N3[C@@H](CSC3=C2[NH+](C)C)C(=O)O | CACTVS 3.385 | C[NH+](C)C1=C2SC[CH](N2C(=O)C=C1Cc3cccc(C)c3C)C(O)=O |
|
Formula | C19 H23 N2 O3 S |
Name | [(3~{R})-3-carboxy-7-[(2,3-dimethylphenyl)methyl]-5-oxidanylidene-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridin-8-yl]-dimethyl-azanium |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6exm Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|