Structure of PDB 6ev0 Chain A Binding Site BS01 |
|
|
Ligand ID | BYK |
InChI | InChI=1S/C21H20N2O3S/c1-22(2)19-15(10-14-8-5-7-13-6-3-4-9-16(13)14)11-18(24)23-17(21(25)26)12-27-20(19)23/h3-9,11,17H,10,12H2,1-2H3,(H,25,26)/p+1/t17-/m0/s1 |
InChIKey | BCEJXMPUFHXHBT-KRWDZBQOSA-O |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | C[NH+](C)C1=C2N([C@@H](CS2)C(=O)O)C(=O)C=C1Cc3cccc4c3cccc4 | CACTVS 3.385 | C[NH+](C)C1=C2SC[CH](N2C(=O)C=C1Cc3cccc4ccccc34)C(O)=O | OpenEye OEToolkits 2.0.6 | C[NH+](C)C1=C2N(C(CS2)C(=O)O)C(=O)C=C1Cc3cccc4c3cccc4 | CACTVS 3.385 | C[NH+](C)C1=C2SC[C@H](N2C(=O)C=C1Cc3cccc4ccccc34)C(O)=O |
|
Formula | C21 H21 N2 O3 S |
Name | [(3~{R})-3-carboxy-7-(naphthalen-1-ylmethyl)-5-oxidanylidene-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridin-8-yl]-dimethyl-azanium |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6ev0 Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|