Structure of PDB 6e6m Chain A Binding Site BS01 |
|
|
Ligand ID | 8CB |
InChI | InChI=1S/C17H22O2/c1-10(2)13-6-5-11(3)7-14(13)17-15(18)8-12(4)9-16(17)19/h7-9,13-14,18-19H,1,5-6H2,2-4H3/t13-,14+/m0/s1 |
InChIKey | GKVOVXWEBSQJPA-UONOGXRCSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Oc2c(C1C(CCC(=C1)C)/C(C)=C)c(O)cc(c2)C | OpenEye OEToolkits 2.0.6 | Cc1cc(c(c(c1)O)C2C=C(CCC2C(=C)C)C)O | CACTVS 3.385 | CC(=C)[CH]1CCC(=C[CH]1c2c(O)cc(C)cc2O)C | CACTVS 3.385 | CC(=C)[C@@H]1CCC(=C[C@H]1c2c(O)cc(C)cc2O)C | OpenEye OEToolkits 2.0.6 | Cc1cc(c(c(c1)O)[C@@H]2C=C(CC[C@H]2C(=C)C)C)O |
|
Formula | C17 H22 O2 |
Name | (1'R,2'R)-4,5'-dimethyl-2'-(prop-1-en-2-yl)-1',2',3',4'-tetrahydro[1,1'-biphenyl]-2,6-diol; cannabidiorcin; CBDO |
ChEMBL | |
DrugBank | |
ZINC | ZINC000013382979
|
PDB chain | 6e6m Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|