Structure of PDB 6e5l Chain A Binding Site BS01 |
|
|
Ligand ID | HVD |
InChI | InChI=1S/C21H30O2/c1-5-6-7-8-16-12-17(22)13-20(23)21(16)19-11-15(4)9-10-18(19)14(2)3/h11-13,18-19,22-23H,2,5-10H2,1,3-4H3/t18-,19+/m0/s1 |
InChIKey | YWEZXUNAYVCODW-RBUKOAKNSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCCCCc1cc(O)cc(O)c1[CH]2C=C(C)CC[CH]2C(C)=C | CACTVS 3.385 | CCCCCc1cc(O)cc(O)c1[C@@H]2C=C(C)CC[C@H]2C(C)=C | OpenEye OEToolkits 2.0.6 | CCCCCc1cc(cc(c1C2C=C(CCC2C(=C)C)C)O)O | ACDLabs 12.01 | C=1(CCC(C(C=1)c2c(CCCCC)cc(cc2O)O)\C(=C)C)C | OpenEye OEToolkits 2.0.6 | CCCCCc1cc(cc(c1[C@@H]2C=C(CC[C@H]2C(=C)C)C)O)O |
|
Formula | C21 H30 O2 |
Name | (1'R,2'R)-5'-methyl-6-pentyl-2'-(prop-1-en-2-yl)-1',2',3',4'-tetrahydro[1,1'-biphenyl]-2,4-diol |
ChEMBL | CHEMBL499876 |
DrugBank | |
ZINC | ZINC000002383092
|
PDB chain | 6e5l Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|