Structure of PDB 6e22 Chain A Binding Site BS01 |
|
|
Ligand ID | HLS |
InChI | InChI=1S/C20H23FN4O3/c1-27-16-7-13(8-17(10-16)28-2)11-24-19(26)14-3-4-18(21)15(9-14)12-25-20-22-5-6-23-20/h3-4,7-10H,5-6,11-12H2,1-2H3,(H,24,26)(H2,22,23,25) |
InChIKey | VDAMWMOTTUWVPR-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | N(C(=O)c1cc(c(F)cc1)CNC2=NCCN2)Cc3cc(cc(c3)OC)OC | OpenEye OEToolkits 2.0.6 | COc1cc(cc(c1)OC)CNC(=O)c2ccc(c(c2)CNC3=NCCN3)F | CACTVS 3.385 | COc1cc(CNC(=O)c2ccc(F)c(CNC3=NCCN3)c2)cc(OC)c1 |
|
Formula | C20 H23 F N4 O3 |
Name | 3-{[(4,5-dihydro-1H-imidazol-2-yl)amino]methyl}-N-[(3,5-dimethoxyphenyl)methyl]-4-fluorobenzamide |
ChEMBL | CHEMBL5172311 |
DrugBank | |
ZINC |
|
PDB chain | 6e22 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|