Structure of PDB 6e1y Chain A Binding Site BS01 |
|
|
Ligand ID | HLM |
InChI | InChI=1S/C19H21ClN4O/c1-13(15-5-3-7-17(20)11-15)24-18(25)16-6-2-4-14(10-16)12-23-19-21-8-9-22-19/h2-7,10-11,13H,8-9,12H2,1H3,(H,24,25)(H2,21,22,23)/t13-/m0/s1 |
InChIKey | ZHGJIKXLESXIHK-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | c2(cc(C(=O)NC(C)c1cccc(c1)Cl)ccc2)CNC3=NCCN3 | CACTVS 3.385 | C[CH](NC(=O)c1cccc(CNC2=NCCN2)c1)c3cccc(Cl)c3 | OpenEye OEToolkits 2.0.6 | C[C@@H](c1cccc(c1)Cl)NC(=O)c2cccc(c2)CNC3=NCCN3 | CACTVS 3.385 | C[C@H](NC(=O)c1cccc(CNC2=NCCN2)c1)c3cccc(Cl)c3 | OpenEye OEToolkits 2.0.6 | CC(c1cccc(c1)Cl)NC(=O)c2cccc(c2)CNC3=NCCN3 |
|
Formula | C19 H21 Cl N4 O |
Name | N-[(1S)-1-(3-chlorophenyl)ethyl]-3-{[(4,5-dihydro-1H-imidazol-2-yl)amino]methyl}benzamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6e1y Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|