Structure of PDB 6dy7 Chain A Binding Site BS01 |
|
|
Ligand ID | HH7 |
InChI | InChI=1S/C12H13Cl2N3O/c13-9-2-3-11(10(14)8-9)18-7-1-4-15-12-16-5-6-17-12/h2-3,5-6,8H,1,4,7H2,(H2,15,16,17) |
InChIKey | UQDWUIGCVIDYPD-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | N(CCCOc1c(cc(Cl)cc1)Cl)c2nccn2 | OpenEye OEToolkits 2.0.6 | c1cc(c(cc1Cl)Cl)OCCCNc2[nH]ccn2 | CACTVS 3.385 | Clc1ccc(OCCCNc2[nH]ccn2)c(Cl)c1 |
|
Formula | C12 H13 Cl2 N3 O |
Name | N-[3-(2,4-dichlorophenoxy)propyl]-1H-imidazol-2-amine |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6dy7 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|