Structure of PDB 6dud Chain A Binding Site BS01 |
|
|
Ligand ID | HB4 |
InChI | InChI=1S/C16H15N5/c17-8-19-14-4-3-10-1-2-11(7-13(10)14)15-12-5-6-18-16(12)21-9-20-15/h1-2,5-9,14H,3-4H2,(H2,17,19)(H,18,20,21)/t14-/m0/s1 |
InChIKey | QXEVLNXNYUXLSG-AWEZNQCLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1cc2c(cc1c3c4cc[nH]c4ncn3)C(CC2)NC=N | ACDLabs 12.01 | c41c(CCC1N\C=N)ccc(c3c2ccnc2ncn3)c4 | CACTVS 3.385 | N=CN[C@H]1CCc2ccc(cc12)c3ncnc4[nH]ccc34 | OpenEye OEToolkits 2.0.6 | c1cc2c(cc1c3c4cc[nH]c4ncn3)[C@H](CC2)NC=N | CACTVS 3.385 | N=CN[CH]1CCc2ccc(cc12)c3ncnc4[nH]ccc34 |
|
Formula | C16 H15 N5 |
Name | N-[(1S)-6-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2,3-dihydro-1H-inden-1-yl]imidoformamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6dud Chain A Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|