Structure of PDB 6dq4 Chain A Binding Site BS01 |
|
|
Ligand ID | K0I |
InChI | InChI=1S/C22H23N5O2/c28-21(29)8-12-24-19-15-20(26-22(25-19)18-7-3-4-11-23-18)27-13-9-16-5-1-2-6-17(16)10-14-27/h1-7,11,15H,8-10,12-14H2,(H,28,29)(H,24,25,26) |
InChIKey | AVZCPICCWKMZDT-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(=O)CCNc1cc(nc(n1)c2ccccn2)N3CCc4ccccc4CC3 | OpenEye OEToolkits 1.7.6 | c1ccc2c(c1)CCN(CC2)c3cc(nc(n3)c4ccccn4)NCCC(=O)O | ACDLabs 12.01 | O=C(O)CCNc2nc(c1ncccc1)nc(c2)N3CCc4c(CC3)cccc4 |
|
Formula | C22 H23 N5 O2 |
Name | 3-[[2-pyridin-2-yl-6-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)pyrimidin-4-yl]amino]propanoic acid; 3-((6-(4,5-dihydro-1H-benzo[d]azepin-3(2H)-yl)-2-(pyridin-2-yl)pyrimidin-4-yl)amino)propanoic acid |
ChEMBL | CHEMBL3188597 |
DrugBank | |
ZINC | ZINC000095616592
|
PDB chain | 6dq4 Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|