Structure of PDB 6di1 Chain A Binding Site BS01 |
|
|
Ligand ID | GJD |
InChI | InChI=1S/C12H18N6O2/c1-2-9(19)16-7-3-4-18(6-7)12-15-5-8(11(14)20)10(13)17-12/h5,7H,2-4,6H2,1H3,(H2,14,20)(H,16,19)(H2,13,15,17)/t7-/m0/s1 |
InChIKey | RFNYKYSEMVFRHS-ZETCQYMHSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | c1(nc(N)c(C(=O)N)cn1)N2CC(NC(CC)=O)CC2 | OpenEye OEToolkits 2.0.6 | CCC(=O)NC1CCN(C1)c2ncc(c(n2)N)C(=O)N | CACTVS 3.385 | CCC(=O)N[CH]1CCN(C1)c2ncc(C(N)=O)c(N)n2 | OpenEye OEToolkits 2.0.6 | CCC(=O)N[C@H]1CCN(C1)c2ncc(c(n2)N)C(=O)N | CACTVS 3.385 | CCC(=O)N[C@H]1CCN(C1)c2ncc(C(N)=O)c(N)n2 |
|
Formula | C12 H18 N6 O2 |
Name | 4-amino-2-[(3S)-3-(propanoylamino)pyrrolidin-1-yl]pyrimidine-5-carboxamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6di1 Chain A Residue 701
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|