Structure of PDB 6dha Chain A Binding Site BS01 |
|
|
Ligand ID | GFV |
InChI | InChI=1S/C19H20N2O4S/c1-12(22)14-4-5-15(20-11-14)8-9-25-16-6-2-13(3-7-16)10-17-18(23)21-19(24)26-17/h2-7,11-12,17,22H,8-10H2,1H3,(H,21,23,24)/t12-,17-/m0/s1 |
InChIKey | OXVFDZYQLGRLCD-SJCJKPOMSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CC(c1ccc(nc1)CCOc2ccc(cc2)CC3C(=O)NC(=O)S3)O | CACTVS 3.385 | C[C@H](O)c1ccc(CCOc2ccc(C[C@@H]3SC(=O)NC3=O)cc2)nc1 | CACTVS 3.385 | C[CH](O)c1ccc(CCOc2ccc(C[CH]3SC(=O)NC3=O)cc2)nc1 | ACDLabs 12.01 | C(Oc2ccc(CC1C(NC(=O)S1)=O)cc2)Cc3ncc(C(C)O)cc3 | OpenEye OEToolkits 2.0.6 | C[C@@H](c1ccc(nc1)CCOc2ccc(cc2)C[C@H]3C(=O)NC(=O)S3)O |
|
Formula | C19 H20 N2 O4 S |
Name | Hydroxy Pioglitazone (M-IV); (5S)-5-{[4-(2-{5-[(1S)-1-hydroxyethyl]pyridin-2-yl}ethoxy)phenyl]methyl}-1,3-thiazolidine-2,4-dione |
ChEMBL | |
DrugBank | |
ZINC | ZINC000006713967
|
PDB chain | 6dha Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|