Structure of PDB 6dew Chain A Binding Site BS01 |
|
|
Ligand ID | FOF |
InChI | InChI=1S/C15H26O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11,16H,5-6,8,10,12H2,1-4H3/b14-9+,15-11+ |
InChIKey | CRDAMVZIKSXKFV-YFVJMOTDSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.7 | CC(=CCCC(=CCCC(=CCO)C)C)C | CACTVS 3.385 | CC(C)=CCCC(C)=CCCC(C)=CCO | CACTVS 3.385 | CC(C)=CCC\C(C)=C\CC/C(C)=C/CO | ACDLabs 12.01 | C\C(=C\CC\C(=C\CCC(C)=[C@H]CO)C)C | OpenEye OEToolkits 2.0.7 | CC(=CCC/C(=C/CC/C(=C/CO)/C)/C)C |
|
Formula | C15 H26 O |
Name | (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-ol; trans,trans-Farnesol |
ChEMBL | CHEMBL25308 |
DrugBank | |
ZINC | ZINC000001532860
|
PDB chain | 6dew Chain A Residue 304
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|