Structure of PDB 6db4 Chain A Binding Site BS01 |
|
|
Ligand ID | G4Y |
InChI | InChI=1S/C22H19N5/c23-12-25-19-9-8-15-6-7-16(10-17(15)19)21-20-18(14-4-2-1-3-5-14)11-24-22(20)27-13-26-21/h1-7,10-13,19H,8-9H2,(H2,23,25)(H,24,26,27)/t19-/m0/s1 |
InChIKey | HLJVDQSXUUSDJP-IBGZPJMESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | N=CN[CH]1CCc2ccc(cc12)c3ncnc4[nH]cc(c5ccccc5)c34 | CACTVS 3.385 | N=CN[C@H]1CCc2ccc(cc12)c3ncnc4[nH]cc(c5ccccc5)c34 | OpenEye OEToolkits 2.0.6 | [H]/N=C/N[C@H]1CCc2c1cc(cc2)c3c4c(c[nH]c4ncn3)c5ccccc5 | ACDLabs 12.01 | n3c1ncnc(c1c(c2ccccc2)c3)c4cc5c(cc4)CCC5NC=[N@H] | OpenEye OEToolkits 2.0.6 | c1ccc(cc1)c2c[nH]c3c2c(ncn3)c4ccc5c(c4)C(CC5)NC=N |
|
Formula | C22 H19 N5 |
Name | N-[(1S)-6-(5-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2,3-dihydro-1H-inden-1-yl]imidoformamide |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6db4 Chain A Residue 4000
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|