Structure of PDB 6db3 Chain A Binding Site BS01 |
|
|
Ligand ID | G54 |
InChI | InChI=1S/C17H15N5/c1-17(22-9-18)6-4-11-2-3-12(8-14(11)17)15-13-5-7-19-16(13)21-10-20-15/h2-3,5,7-8,10,22H,4,6H2,1H3,(H,19,20,21)/t17-/m0/s1 |
InChIKey | PTCVBQDKOCSZKC-KRWDZBQOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[C]1(CCc2ccc(cc12)c3ncnc4[nH]ccc34)NC#N | CACTVS 3.385 | C[C@@]1(CCc2ccc(cc12)c3ncnc4[nH]ccc34)NC#N | ACDLabs 12.01 | n4c3ncnc(c1cc2c(cc1)CCC2(NC#N)C)c3cc4 | OpenEye OEToolkits 2.0.6 | C[C@@]1(CCc2c1cc(cc2)c3c4cc[nH]c4ncn3)NC#N | OpenEye OEToolkits 2.0.6 | CC1(CCc2c1cc(cc2)c3c4cc[nH]c4ncn3)NC#N |
|
Formula | C17 H15 N5 |
Name | [(1S)-1-methyl-6-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-2,3-dihydro-1H-inden-1-yl]cyanamide |
ChEMBL | CHEMBL4279720 |
DrugBank | |
ZINC |
|
PDB chain | 6db3 Chain A Residue 4000
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|