Structure of PDB 6cn6 Chain A Binding Site BS01 |
|
|
Ligand ID | F7J |
InChI | InChI=1S/C29H32N4O2/c1-19-25(31-28(34)23-9-5-6-20(16-23)17-30)10-11-26-27(19)24(18-32(26)2)21-12-14-33(15-13-21)29(35)22-7-3-4-8-22/h5-6,9-11,16,18,21-22H,3-4,7-8,12-15H2,1-2H3,(H,31,34) |
InChIKey | HQKLWNNRWVVUSC-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | N(C(c1cccc(c1)C#N)=O)c5ccc2c(c(cn2C)C4CCN(C(C3CCCC3)=O)CC4)c5C | OpenEye OEToolkits 2.0.6 | Cc1c(ccc2c1c(cn2C)C3CCN(CC3)C(=O)C4CCCC4)NC(=O)c5cccc(c5)C#N | CACTVS 3.385 | Cn1cc(C2CCN(CC2)C(=O)C3CCCC3)c4c(C)c(NC(=O)c5cccc(c5)C#N)ccc14 |
|
Formula | C29 H32 N4 O2 |
Name | 3-cyano-N-{3-[1-(cyclopentanecarbonyl)piperidin-4-yl]-1,4-dimethyl-1H-indol-5-yl}benzamide |
ChEMBL | CHEMBL4290728 |
DrugBank | |
ZINC |
|
PDB chain | 6cn6 Chain A Residue 4000
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|