Structure of PDB 6chq Chain A Binding Site BS01 |
|
|
Ligand ID | F0V |
InChI | InChI=1S/C20H18ClN5/c1-13-8-9-16(12-17(13)21)23-19-10-14(2)22-20-24-18(25-26(19)20)11-15-6-4-3-5-7-15/h3-10,12H,11H2,1-2H3,(H,22,23,24,25)/p+1 |
InChIKey | QGHMESXINCFELP-UHFFFAOYSA-O |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | c1(c(Cl)cc(cc1)Nc4[n+]3c(nc(Cc2ccccc2)n3)nc(C)c4)C | CACTVS 3.385 | Cc1cc(Nc2ccc(C)c(Cl)c2)[n+]3nc(Cc4ccccc4)[nH]c3n1 | OpenEye OEToolkits 2.0.6 | Cc1ccc(cc1Cl)Nc2cc(nc3[n+]2nc([nH]3)Cc4ccccc4)C |
|
Formula | C20 H19 Cl N5 |
Name | 2-benzyl-7-[(3-chloro-4-methylphenyl)amino]-5-methyl-3H-[1,2,4]triazolo[1,5-a]pyrimidin-8-ium |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6chq Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
H18 K42 R91 S129 |
Catalytic site (residue number reindexed from 1) |
H18 K42 R91 S129 |
Enzyme Commision number |
2.7.7.3: pantetheine-phosphate adenylyltransferase. |
|
|
|