Structure of PDB 6cho Chain A Binding Site BS01 |
|
|
Ligand ID | F14 |
InChI | InChI=1S/C21H21N5O3/c1-13-11-19(27)26-21(22-13)24-20(25-26)23-14(2)15-5-4-6-18(12-15)29-17-9-7-16(28-3)8-10-17/h4-10,12,14H,11H2,1-3H3,(H,23,25)/t14-/m1/s1 |
InChIKey | URYYGXLOJAHXGW-CQSZACIVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CC1=Nc2nc(nn2C(=O)C1)NC(C)c3cccc(c3)Oc4ccc(cc4)OC | CACTVS 3.385 | COc1ccc(Oc2cccc(c2)[C@@H](C)Nc3nn4C(=O)CC(=Nc4n3)C)cc1 | ACDLabs 12.01 | c1(ccc(cc1)Oc4cc(C(Nc3nc2N=C(CC(=O)n2n3)C)C)ccc4)OC | CACTVS 3.385 | COc1ccc(Oc2cccc(c2)[CH](C)Nc3nn4C(=O)CC(=Nc4n3)C)cc1 | OpenEye OEToolkits 2.0.6 | CC1=Nc2nc(nn2C(=O)C1)N[C@H](C)c3cccc(c3)Oc4ccc(cc4)OC |
|
Formula | C21 H21 N5 O3 |
Name | 2-({(1R)-1-[3-(4-methoxyphenoxy)phenyl]ethyl}amino)-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7(6H)-one |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6cho Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
H18 K42 R91 S129 |
Catalytic site (residue number reindexed from 1) |
H18 K42 R91 S129 |
Enzyme Commision number |
2.7.7.3: pantetheine-phosphate adenylyltransferase. |
|
|
|