Structure of PDB 6chn Chain A Binding Site BS01 |
|
|
Ligand ID | F1D |
InChI | InChI=1S/C22H25N7O4/c1-14-12-19(30)29-21(24-14)26-20(27-29)25-18(6-9-23)15-4-3-5-17(13-15)33-16-7-10-28(11-8-16)22(31)32-2/h3-5,13,16,18H,6-8,10-12H2,1-2H3,(H,25,27)/t18-/m1/s1 |
InChIKey | BAVCOKCQUYWPLU-GOSISDBHSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CC1=Nc2nc(nn2C(=O)C1)NC(CC#N)c3cccc(c3)OC4CCN(CC4)C(=O)OC | OpenEye OEToolkits 2.0.6 | CC1=Nc2nc(nn2C(=O)C1)N[C@H](CC#N)c3cccc(c3)OC4CCN(CC4)C(=O)OC | ACDLabs 12.01 | C(=O)(N4CCC(Oc3cc(C(Nc1nn2C(=O)CC(=Nc2n1)C)CC#N)ccc3)CC4)OC | CACTVS 3.385 | COC(=O)N1CCC(CC1)Oc2cccc(c2)[CH](CC#N)Nc3nn4C(=O)CC(=Nc4n3)C | CACTVS 3.385 | COC(=O)N1CCC(CC1)Oc2cccc(c2)[C@@H](CC#N)Nc3nn4C(=O)CC(=Nc4n3)C |
|
Formula | C22 H25 N7 O4 |
Name | methyl 4-(3-{(1R)-2-cyano-1-[(5-methyl-7-oxo-6,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)amino]ethyl}phenoxy)piperidine-1-carboxylate |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6chn Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
H18 K42 R91 S129 |
Catalytic site (residue number reindexed from 1) |
H16 K40 R89 S127 |
Enzyme Commision number |
2.7.7.3: pantetheine-phosphate adenylyltransferase. |
|
|
|