Structure of PDB 6cco Chain A Binding Site BS01 |
|
|
Ligand ID | EXV |
InChI | InChI=1S/C19H18N2O3/c22-16-9-3-8-15-17(16)21-18(20-15)14-7-2-6-13(14)11-4-1-5-12(10-11)19(23)24/h1,3-5,8-10,13-14,22H,2,6-7H2,(H,20,21)(H,23,24)/t13-,14+/m1/s1 |
InChIKey | HDENXLNFCHSDIF-KGLIPLIRSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | c1cc(cc(c1)C(=O)O)[C@H]2CCC[C@@H]2c3[nH]c4c(n3)cccc4O | CACTVS 3.385 | OC(=O)c1cccc(c1)[CH]2CCC[CH]2c3[nH]c4c(O)cccc4n3 | ACDLabs 12.01 | c1(cccc(c1)C2C(CCC2)c3nc4c(n3)cccc4O)C(=O)O | OpenEye OEToolkits 2.0.6 | c1cc(cc(c1)C(=O)O)C2CCCC2c3[nH]c4c(n3)cccc4O | CACTVS 3.385 | OC(=O)c1cccc(c1)[C@H]2CCC[C@@H]2c3[nH]c4c(O)cccc4n3 |
|
Formula | C19 H18 N2 O3 |
Name | 3-[(1S,2S)-2-(7-hydroxy-1H-benzimidazol-2-yl)cyclopentyl]benzoic acid |
ChEMBL | CHEMBL4102188 |
DrugBank | |
ZINC |
|
PDB chain | 6cco Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
H18 K42 R91 S129 |
Catalytic site (residue number reindexed from 1) |
H18 K42 R91 S129 |
Enzyme Commision number |
2.7.7.3: pantetheine-phosphate adenylyltransferase. |
|
|
|