Structure of PDB 6ccm Chain A Binding Site BS01 |
|
|
Ligand ID | EXP |
InChI | InChI=1S/C13H12BrN5O/c1-8-5-11(20)19-13(16-8)17-12(18-19)15-7-9-3-2-4-10(14)6-9/h2-4,6H,5,7H2,1H3,(H,15,18) |
InChIKey | NONMKRIVUVFGSW-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | c12nc(nn1C(CC(C)=N2)=O)NCc3cc(ccc3)Br | OpenEye OEToolkits 2.0.6 | CC1=Nc2nc(nn2C(=O)C1)NCc3cccc(c3)Br | CACTVS 3.385 | CC1=Nc2nc(NCc3cccc(Br)c3)nn2C(=O)C1 |
|
Formula | C13 H12 Br N5 O |
Name | 2-{[(3-bromophenyl)methyl]amino}-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7(6H)-one |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6ccm Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
H18 K42 R91 S129 |
Catalytic site (residue number reindexed from 1) |
H18 K42 R91 S129 |
Enzyme Commision number |
2.7.7.3: pantetheine-phosphate adenylyltransferase. |
|
|
|