Structure of PDB 6c2i Chain A Binding Site BS01 |
|
|
Ligand ID | EJ7 |
InChI | InChI=1S/C18H18FN5O3/c1-18(11-6-14(11)27-17(20)24-18)10-5-9(3-4-12(10)19)23-16(25)13-7-22-15(26-2)8-21-13/h3-5,7-8,11,14H,6H2,1-2H3,(H2,20,24)(H,23,25)/t11-,14+,18+/m0/s1 |
InChIKey | LUOFRFUNXXGHFC-UCMVZMLTSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CC1(C2CC2OC(=N1)N)c3cc(ccc3F)NC(=O)c4cnc(cn4)OC | CACTVS 3.385 | COc1cnc(cn1)C(=O)Nc2ccc(F)c(c2)[C]3(C)N=C(N)O[CH]4C[CH]34 | ACDLabs 12.01 | c1(cc(c(cc1)F)C3(C)C2CC2OC(=N3)N)NC(=O)c4cnc(cn4)OC | OpenEye OEToolkits 2.0.6 | C[C@]1([C@H]2C[C@H]2OC(=N1)N)c3cc(ccc3F)NC(=O)c4cnc(cn4)OC | CACTVS 3.385 | COc1cnc(cn1)C(=O)Nc2ccc(F)c(c2)[C@@]3(C)N=C(N)O[C@@H]4C[C@H]34 |
|
Formula | C18 H18 F N5 O3 |
Name | N-{3-[(1R,5S,6R)-3-amino-5-methyl-2-oxa-4-azabicyclo[4.1.0]hept-3-en-5-yl]-4-fluorophenyl}-5-methoxypyrazine-2-carboxamide |
ChEMBL | CHEMBL3693258 |
DrugBank | |
ZINC | ZINC000226050910
|
PDB chain | 6c2i Chain A Residue 407
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|