Structure of PDB 6bgu Chain A Binding Site BS01 |
|
|
Ligand ID | DKP |
InChI | InChI=1S/C18H17ClN2O3/c1-2-9-24-17(11-5-3-4-6-13(11)19)15-10-14-16(21-15)12(18(22)23)7-8-20-14/h3-8,10,17,21H,2,9H2,1H3,(H,22,23)/t17-/m1/s1 |
InChIKey | NXCXDWJNFKFGCO-QGZVFWFLSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | c3cccc(C(c1nc2c(c1)nccc2C(=O)O)OCCC)c3Cl | OpenEye OEToolkits 2.0.6 | CCCOC(c1ccccc1Cl)c2cc3c([nH]2)c(ccn3)C(=O)O | OpenEye OEToolkits 2.0.6 | CCCO[C@H](c1ccccc1Cl)c2cc3c([nH]2)c(ccn3)C(=O)O | CACTVS 3.385 | CCCO[CH](c1[nH]c2c(c1)nccc2C(O)=O)c3ccccc3Cl | CACTVS 3.385 | CCCO[C@@H](c1[nH]c2c(c1)nccc2C(O)=O)c3ccccc3Cl |
|
Formula | C18 H17 Cl N2 O3 |
Name | 2-[(R)-(2-chlorophenyl)(propoxy)methyl]-1H-pyrrolo[3,2-b]pyridine-7-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6bgu Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|