Structure of PDB 6bg5 Chain A Binding Site BS01 |
|
|
Ligand ID | DQD |
InChI | InChI=1S/C24H28F3N3O3/c1-2-10-29-11-8-20(9-12-29)30(15-17-6-7-21-22(13-17)33-16-32-21)23(31)28-19-5-3-4-18(14-19)24(25,26)27/h3-7,13-14,20H,2,8-12,15-16H2,1H3,(H,28,31) |
InChIKey | PLBHVOJLFQGHAQ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CCCN1CCC(CC1)N(Cc2ccc3c(c2)OCO3)C(=O)Nc4cccc(c4)C(F)(F)F | CACTVS 3.385 | CCCN1CCC(CC1)N(Cc2ccc3OCOc3c2)C(=O)Nc4cccc(c4)C(F)(F)F | ACDLabs 12.01 | FC(F)(F)c1cccc(c1)NC(=O)N(C2CCN(CC2)CCC)Cc3ccc4c(c3)OCO4 |
|
Formula | C24 H28 F3 N3 O3 |
Name | N-[(2H-1,3-benzodioxol-5-yl)methyl]-N-(1-propylpiperidin-4-yl)-N'-[3-(trifluoromethyl)phenyl]urea |
ChEMBL | CHEMBL4104419 |
DrugBank | |
ZINC |
|
PDB chain | 6bg5 Chain A Residue 1301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
E11 D20 |
Catalytic site (residue number reindexed from 1) |
E24 D33 |
Enzyme Commision number |
3.2.1.17: lysozyme. |
|
|
|