Structure of PDB 6bbu Chain A Binding Site BS01 |
|
|
Ligand ID | D7D |
InChI | InChI=1S/C14H21N5O2S/c1-3-6-22(20,21)18-10-7-11(8-10)19(2)14-12-4-5-15-13(12)16-9-17-14/h4-5,9-11,18H,3,6-8H2,1-2H3,(H,15,16,17)/t10-,11+ |
InChIKey | IUEWXNHSKRWHDY-PHIMTYICSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CCCS(=O)(=O)NC1CC(C1)N(C)c2c3cc[nH]c3ncn2 | CACTVS 3.385 | CCC[S](=O)(=O)N[CH]1C[CH](C1)N(C)c2ncnc3[nH]ccc23 | CACTVS 3.385 | CCC[S](=O)(=O)N[C@@H]1C[C@@H](C1)N(C)c2ncnc3[nH]ccc23 | ACDLabs 12.01 | c31nccc1c(N(C2CC(NS(CCC)(=O)=O)C2)C)ncn3 |
|
Formula | C14 H21 N5 O2 S |
Name | N-{cis-3-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]cyclobutyl}propane-1-sulfonamide |
ChEMBL | CHEMBL3655081 |
DrugBank | DB14973 |
ZINC |
|
PDB chain | 6bbu Chain A Residue 4000
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|