Structure of PDB 6b2q Chain A Binding Site BS01 |
|
|
Ligand ID | CJJ |
InChI | InChI=1S/C14H13ClN6O2S2/c15-8-6-17-14(10-3-4-12(24-10)25(16,22)23)19-13(8)18-11-5-9(20-21-11)7-1-2-7/h3-7H,1-2H2,(H2,16,22,23)(H2,17,18,19,20,21) |
InChIKey | KRMDPWLIHGQVGZ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | c4(c3ncc(c(Nc1cc(nn1)C2CC2)n3)Cl)ccc(s4)S(=O)(=O)N | OpenEye OEToolkits 2.0.6 | c1cc(sc1c2ncc(c(n2)Nc3cc([nH]n3)C4CC4)Cl)S(=O)(=O)N | CACTVS 3.385 | N[S](=O)(=O)c1sc(cc1)c2ncc(Cl)c(Nc3cc([nH]n3)C4CC4)n2 |
|
Formula | C14 H13 Cl N6 O2 S2 |
Name | 5-{5-chloro-4-[(5-cyclopropyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl}thiophene-2-sulfonamide |
ChEMBL | CHEMBL4162308 |
DrugBank | |
ZINC |
|
PDB chain | 6b2q Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|