Structure of PDB 6ai9 Chain A Binding Site BS01 |
|
|
Ligand ID | PAZ |
InChI | InChI=1S/C9H18NO8P/c1-9(2,5-18-19(15,16)17)7(13)8(14)10-4-3-6(11)12/h7,13H,3-5H2,1-2H3,(H,10,14)(H,11,12)(H2,15,16,17)/t7-/m0/s1 |
InChIKey | XHFVGHPGDLDEQO-ZETCQYMHSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CC(C)(COP(=O)(O)O)[C@H](C(=O)NCCC(=O)O)O | OpenEye OEToolkits 1.5.0 | CC(C)(COP(=O)(O)O)C(C(=O)NCCC(=O)O)O | CACTVS 3.341 | CC(C)(CO[P](O)(O)=O)[CH](O)C(=O)NCCC(O)=O | ACDLabs 10.04 | O=P(OCC(C(O)C(=O)NCCC(=O)O)(C)C)(O)O | CACTVS 3.341 | CC(C)(CO[P](O)(O)=O)[C@@H](O)C(=O)NCCC(O)=O |
|
Formula | C9 H18 N O8 P |
Name | N-[(2R)-2-hydroxy-3,3-dimethyl-4-(phosphonooxy)butanoyl]-beta-alanine |
ChEMBL | |
DrugBank | DB16966 |
ZINC | ZINC000001529671
|
PDB chain | 6ai9 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
6.3.2.5: phosphopantothenate--cysteine ligase (CTP). |
|
|
|