Structure of PDB 6ahs Chain A Binding Site BS01 |
|
|
Ligand ID | 9YO |
InChI | InChI=1S/C19H18ClN3O2S/c1-12-7-8-18-14(9-12)15(17-10-21-13(2)22-17)11-23(18)26(24,25)19-6-4-3-5-16(19)20/h3-9,11,17H,10H2,1-2H3,(H,21,22)/t17-/m0/s1 |
InChIKey | QKLXECCUITXSOU-KRWDZBQOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | Cc1ccc2n(cc([CH]3CNC(=N3)C)c2c1)[S](=O)(=O)c4ccccc4Cl | ACDLabs 12.01 | c4(S(=O)(n3c1ccc(C)cc1c(C2CNC(C)=N2)c3)=O)ccccc4Cl | OpenEye OEToolkits 2.0.6 | Cc1ccc2c(c1)c(cn2S(=O)(=O)c3ccccc3Cl)C4CNC(=N4)C | OpenEye OEToolkits 2.0.6 | Cc1ccc2c(c1)c(cn2S(=O)(=O)c3ccccc3Cl)[C@@H]4CNC(=N4)C | CACTVS 3.385 | Cc1ccc2n(cc([C@@H]3CNC(=N3)C)c2c1)[S](=O)(=O)c4ccccc4Cl |
|
Formula | C19 H18 Cl N3 O2 S |
Name | 1-[(2-chlorophenyl)sulfonyl]-5-methyl-3-[(4R)-2-methyl-4,5-dihydro-1H-imidazol-4-yl]-1H-indole |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6ahs Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|