Structure of PDB 6a1h Chain A Binding Site BS01 |
|
|
Ligand ID | 9O9 |
InChI | InChI=1S/C18H22N3O9P/c1-8-3-10-5-11-16(19-18(26)20-17(11)25)21(12(10)4-9(8)2)6-13(22)15(24)14(23)7-30-31(27,28)29/h3-5,13-15,22-24H,6-7H2,1-2H3,(H,20,25,26)(H2,27,28,29)/t13-,14+,15-/m0/s1 |
InChIKey | LAWFKZVKVIYTAR-ZNMIVQPWSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | C3(=O)C2=Cc1c(cc(c(C)c1)C)N(C2=NC(N3)=O)CC(C(C(O)COP(O)(O)=O)O)O | CACTVS 3.385 | Cc1cc2C=C3C(=O)NC(=O)N=C3N(C[C@H](O)[C@H](O)[C@H](O)CO[P](O)(O)=O)c2cc1C | OpenEye OEToolkits 2.0.6 | Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=C2)C[C@@H]([C@@H]([C@@H](COP(=O)(O)O)O)O)O | CACTVS 3.385 | Cc1cc2C=C3C(=O)NC(=O)N=C3N(C[CH](O)[CH](O)[CH](O)CO[P](O)(O)=O)c2cc1C | OpenEye OEToolkits 2.0.6 | Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=C2)CC(C(C(COP(=O)(O)O)O)O)O |
|
Formula | C18 H22 N3 O9 P |
Name | 1-deoxy-1-(7,8-dimethyl-2,4-dioxo-3,4-dihydropyrimido[4,5-b]quinolin-10(2H)-yl)-5-O-phosphono-D-ribitol |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 6a1h Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
F128 D156 H252 |
Catalytic site (residue number reindexed from 1) |
F126 D154 H227 |
Enzyme Commision number |
1.1.3.46: 4-hydroxymandelate oxidase. |
|
|
|