Structure of PDB 6a17 Chain A Binding Site BS01 |
|
|
Ligand ID | 9RL |
InChI | InChI=1S/C18H18ClN3O/c1-18(23,15-5-3-2-4-6-15)17(22-13-20-12-21-22)11-14-7-9-16(19)10-8-14/h2-10,12-13,17,23H,11H2,1H3/t17-,18+/m0/s1 |
InChIKey | YULDTPKHZNKFEY-ZWKOTPCHSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CC(c1ccccc1)(C(Cc2ccc(cc2)Cl)n3cncn3)O | CACTVS 3.385 | C[C@](O)([C@H](Cc1ccc(Cl)cc1)n2cncn2)c3ccccc3 | ACDLabs 12.01 | C(C(C(C)(O)c1ccccc1)n2cncn2)c3ccc(cc3)Cl | CACTVS 3.385 | C[C](O)([CH](Cc1ccc(Cl)cc1)n2cncn2)c3ccccc3 | OpenEye OEToolkits 2.0.6 | C[C@@](c1ccccc1)([C@H](Cc2ccc(cc2)Cl)n3cncn3)O |
|
Formula | C18 H18 Cl N3 O |
Name | (2R,3S)-4-(4-chlorophenyl)-2-phenyl-3-(1H-1,2,4-triazol-1-yl)butan-2-ol |
ChEMBL | |
DrugBank | |
ZINC | ZINC000027428844
|
PDB chain | 6a17 Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.14.14.178: steroid 22S-hydroxylase. |
|
|
|