Structure of PDB 5ztn Chain A Binding Site BS01 |
|
|
Ligand ID | CUR |
InChI | InChI=1S/C21H20O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h3-13,22,24-25H,1-2H3/b7-3+,8-4-,16-13- |
InChIKey | ZIUSSTSXXLLKKK-JXTJPBKQSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.9.2 | COc1cc(ccc1O)/C=C/C(=C/C(=O)/C=C\c2ccc(c(c2)OC)O)/O | CACTVS 3.385 | COc1cc(/C=C/C(O)=C/C(=O)\C=C/c2ccc(O)c(OC)c2)ccc1O | OpenEye OEToolkits 1.9.2 | COc1cc(ccc1O)C=CC(=CC(=O)C=Cc2ccc(c(c2)OC)O)O | CACTVS 3.385 | COc1cc(C=CC(O)=CC(=O)C=Cc2ccc(O)c(OC)c2)ccc1O | ACDLabs 12.01 | O=C(\C=C(/O)\C=C\c1ccc(O)c(OC)c1)\C=C/c2cc(OC)c(O)cc2 |
|
Formula | C21 H20 O6 |
Name | (1Z,4Z,6E)-5-hydroxy-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,4,6-trien-3-one; Curcumin, enol form |
ChEMBL | |
DrugBank | |
ZINC | ZINC000104896565
|
PDB chain | 5ztn Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|