Structure of PDB 5yfx Chain A Binding Site BS01 |
|
|
Ligand ID | RI2 |
InChI | InChI=1S/C5H12O11P2/c6-3-2(1-14-17(8,9)10)15-5(4(3)7)16-18(11,12)13/h2-7H,1H2,(H2,8,9,10)(H2,11,12,13)/t2-,3-,4-,5-/m1/s1 |
InChIKey | AAAFZMYJJHWUPN-TXICZTDVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | C([C@@H]1[C@H]([C@H]([C@H](O1)OP(=O)(O)O)O)O)OP(=O)(O)O | CACTVS 3.370 | O[CH]1[CH](O)[CH](O[CH]1CO[P](O)(O)=O)O[P](O)(O)=O | ACDLabs 12.01 | O=P(O)(O)OCC1OC(OP(=O)(O)O)C(O)C1O | OpenEye OEToolkits 1.7.0 | C(C1C(C(C(O1)OP(=O)(O)O)O)O)OP(=O)(O)O | CACTVS 3.370 | O[C@H]1[C@@H](O)[C@H](O[C@@H]1CO[P](O)(O)=O)O[P](O)(O)=O |
|
Formula | C5 H12 O11 P2 |
Name | 1,5-di-O-phosphono-alpha-D-ribofuranose; 1,5-di-O-phosphono-alpha-D-ribose; 1,5-di-O-phosphono-D-ribose; 1,5-di-O-phosphono-ribose |
ChEMBL | |
DrugBank | |
ZINC | ZINC000013522068
|
PDB chain | 5yfx Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
5.3.1.29: ribose-1,5-bisphosphate isomerase. |
|
|
|